C17H25FN2O3 — CID 111969771
3-[2-(cyclopropylmethoxy)-4-fluorophenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea (PubChem CID 111969771) has the molecular formula C17H25FN2O3 and a molecular weight of 324.40 g/mol. Its IUPAC name is 3-[2-(cyclopropylmethoxy)-4-fluorophenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea.
| Compound Name | 3-[2-(cyclopropylmethoxy)-4-fluorophenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea |
|---|---|
| PubChem CID | 111969771 |
| Molecular Formula | C17H25FN2O3 |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-[2-(cyclopropylmethoxy)-4-fluorophenyl]-1-(2-hydroxypropyl)-1-propan-2-ylurea |
| SMILES | CC(O)CN(C(=O)Nc1ccc(F)cc1OCC1CC1)C(C)C |
| InChI | InChI=1S/C17H25FN2O3/c1-11(2)20(9-12(3)21)17(22)19-15-7-6-14(18)8-16(15)23-10-13-4-5-13/h6-8,11-13,21H,4-5,9-10H2,1-3H3,(H,19,22) |
| InChIKey | AGYDGVOILJGLDU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |