C17H23FN2O3 — CID 111453694
1-[2-(cyclopropylmethoxy)-4-fluorophenyl]-3-[(1-hydroxycyclopentyl)methyl]urea (PubChem CID 111453694) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)-4-fluorophenyl]-3-[(1-hydroxycyclopentyl)methyl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)-4-fluorophenyl]-3-[(1-hydroxycyclopentyl)methyl]urea |
|---|---|
| PubChem CID | 111453694 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)-4-fluorophenyl]-3-[(1-hydroxycyclopentyl)methyl]urea |
| SMILES | O=C(NCC1(O)CCCC1)Nc1ccc(F)cc1OCC1CC1 |
| InChI | InChI=1S/C17H23FN2O3/c18-13-5-6-14(15(9-13)23-10-12-3-4-12)20-16(21)19-11-17(22)7-1-2-8-17/h5-6,9,12,22H,1-4,7-8,10-11H2,(H2,19,20,21) |
| InChIKey | BUTRKYLAVIUGGS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |