C17H21FN2O3 — CID 111475233
1-(4-fluoro-2-prop-2-ynoxyphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111475233) has the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-(4-fluoro-2-prop-2-ynoxyphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-(4-fluoro-2-prop-2-ynoxyphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111475233 |
| Molecular Formula | C17H21FN2O3 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1-(4-fluoro-2-prop-2-ynoxyphenyl)-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | C#CCOc1cc(F)ccc1NC(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C17H21FN2O3/c1-2-8-23-16-10-13(18)6-7-15(16)20-17(22)19-11-12-4-3-5-14(21)9-12/h1,6-7,10,12,14,21H,3-5,8-9,11H2,(H2,19,20,22) |
| InChIKey | TXSSHPHGBDPMMN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|