C16H22F2N2O2 — CID 111503713
1-[1-(2,4-difluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111503713) has the molecular formula C16H22F2N2O2 and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111503713 |
| Molecular Formula | C16H22F2N2O2 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | CC(NC(=O)NCC1CCCC(O)C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H22F2N2O2/c1-10(14-6-5-12(17)8-15(14)18)20-16(22)19-9-11-3-2-4-13(21)7-11/h5-6,8,10-11,13,21H,2-4,7,9H2,1H3,(H2,19,20,22) |
| InChIKey | GBACFFUWBPIVJQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |