C16H22ClFN2O2 — CID 111505263
1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111505263) has the molecular formula C16H22ClFN2O2 and a molecular weight of 328.81 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111505263 |
| Molecular Formula | C16H22ClFN2O2 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | CC(NC(=O)NCC1CCCC(O)C1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H22ClFN2O2/c1-10(12-5-6-15(18)14(17)8-12)20-16(22)19-9-11-3-2-4-13(21)7-11/h5-6,8,10-11,13,21H,2-4,7,9H2,1H3,(H2,19,20,22) |
| InChIKey | TXQIPACBGWZCTD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |