C19H25FN2O3 — CID 111505700
1-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea (PubChem CID 111505700) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea.
| Compound Name | 1-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 111505700 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[1-(5-fluoro-3-methyl-1-benzofuran-2-yl)ethyl]-3-[(3-hydroxycyclohexyl)methyl]urea |
| SMILES | Cc1c(C(C)NC(=O)NCC2CCCC(O)C2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C19H25FN2O3/c1-11-16-9-14(20)6-7-17(16)25-18(11)12(2)22-19(24)21-10-13-4-3-5-15(23)8-13/h6-7,9,12-13,15,23H,3-5,8,10H2,1-2H3,(H2,21,22,24) |
| InChIKey | KLFHLKNYUZVOLR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |