C15H12ClNO3S — CID 111972003
7-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-1-benzofuran-2-carboxamide (PubChem CID 111972003) has the molecular formula C15H12ClNO3S and a molecular weight of 321.79 g/mol. Its IUPAC name is 7-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 7-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111972003 |
| Molecular Formula | C15H12ClNO3S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 7-chloro-N-(2-hydroxy-2-thiophen-3-ylethyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C15H12ClNO3S/c16-11-3-1-2-9-6-13(20-14(9)11)15(19)17-7-12(18)10-4-5-21-8-10/h1-6,8,12,18H,7H2,(H,17,19) |
| InChIKey | CWFBQSYKCLPLGD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |