C17H13ClFNO3 — CID 111972025
7-chloro-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide (PubChem CID 111972025) has the molecular formula C17H13ClFNO3 and a molecular weight of 333.75 g/mol. Its IUPAC name is 7-chloro-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 7-chloro-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 111972025 |
| Molecular Formula | C17H13ClFNO3 |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 7-chloro-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCC(O)c1ccccc1F)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C17H13ClFNO3/c18-12-6-3-4-10-8-15(23-16(10)12)17(22)20-9-14(21)11-5-1-2-7-13(11)19/h1-8,14,21H,9H2,(H,20,22) |
| InChIKey | HGEXQXYWMIJRQD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |