C22H27FIN5O — CID 111972435
1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111972435) has the molecular formula C22H27FIN5O and a molecular weight of 523.39 g/mol. Its IUPAC name is 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111972435 |
| Molecular Formula | C22H27FIN5O |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-3-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1ccc(OCC2CC2)nc1.I |
| InChI | InChI=1S/C22H26FN5O.HI/c1-24-22(25-9-8-17-13-26-20-6-5-18(23)10-19(17)20)28-12-16-4-7-21(27-11-16)29-14-15-2-3-15;/h4-7,10-11,13,15,26H,2-3,8-9,12,14H2,1H3,(H2,24,25,28);1H |
| InChIKey | UUHIOMMRWOFFBG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|