C21H31N5 — CID 111974400
1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine (PubChem CID 111974400) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine.
| Compound Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111974400 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 1-[(1-cyclopropylpyrrolidin-3-yl)methyl]-2-methyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2cc(C)ccc12)NCC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C21H31N5/c1-15-3-6-19-17(13-24-20(19)11-15)7-9-23-21(22-2)25-12-16-8-10-26(14-16)18-4-5-18/h3,6,11,13,16,18,24H,4-5,7-10,12,14H2,1-2H3,(H2,22,23,25) |
| InChIKey | DIPFIVWRBZZVMR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|