C12H24N2O3 — CID 111974917
N-(2-ethoxyethyl)-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide (PubChem CID 111974917) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-ethoxyethyl)-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 111974917 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N-(2-ethoxyethyl)-2-[3-(hydroxymethyl)piperidin-1-yl]acetamide |
| SMILES | CCOCCNC(=O)CN1CCCC(CO)C1 |
| InChI | InChI=1S/C12H24N2O3/c1-2-17-7-5-13-12(16)9-14-6-3-4-11(8-14)10-15/h11,15H,2-10H2,1H3,(H,13,16) |
| InChIKey | HFWJKNDGRWZVKJ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|