C12H26ClN3O2 — CID 119919895
N-(2-ethoxyethyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride (PubChem CID 119919895) has the molecular formula C12H26ClN3O2 and a molecular weight of 279.81 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride.
| Compound Name | N-(2-ethoxyethyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119919895 |
| Molecular Formula | C12H26ClN3O2 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-(2-ethoxyethyl)-2-[3-(methylamino)piperidin-1-yl]acetamide;hydrochloride |
| SMILES | CCOCCNC(=O)CN1CCCC(NC)C1.Cl |
| InChI | InChI=1S/C12H25N3O2.ClH/c1-3-17-8-6-14-12(16)10-15-7-4-5-11(9-15)13-2;/h11,13H,3-10H2,1-2H3,(H,14,16);1H |
| InChIKey | KAKNFNNRWILLBM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|