C17H28ClN3OS — CID 119919434
2-[3-(methylamino)piperidin-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide;hydrochloride (PubChem CID 119919434) has the molecular formula C17H28ClN3OS and a molecular weight of 357.95 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide;hydrochloride.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119919434 |
| Molecular Formula | C17H28ClN3OS |
| Molecular Weight | 357.95 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide;hydrochloride |
| SMILES | CNC1CCCN(CC(=O)NCCSc2ccc(C)cc2)C1.Cl |
| InChI | InChI=1S/C17H27N3OS.ClH/c1-14-5-7-16(8-6-14)22-11-9-19-17(21)13-20-10-3-4-15(12-20)18-2;/h5-8,15,18H,3-4,9-13H2,1-2H3,(H,19,21);1H |
| InChIKey | WVQNXCHEZUNCQJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.95 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|