C21H30N4O2S — CID 86895544
2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 86895544) has the molecular formula C21H30N4O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is 2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 86895544 |
| Molecular Formula | C21H30N4O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-[2-[(3,5-dimethylpyrazol-1-yl)methyl]morpholin-4-yl]-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | Cc1ccc(SCCNC(=O)CN2CCOC(Cn3nc(C)cc3C)C2)cc1 |
| InChI | InChI=1S/C21H30N4O2S/c1-16-4-6-20(7-5-16)28-11-8-22-21(26)15-24-9-10-27-19(13-24)14-25-18(3)12-17(2)23-25/h4-7,12,19H,8-11,13-15H2,1-3H3,(H,22,26) |
| InChIKey | SYNPECBMGDCMIX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|