About 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol
2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol (PubChem CID 111977137) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol |
| PubChem CID | 111977137 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol |
| SMILES | CC1(C)Cc2cc(CNC(C)(CO)C3CC3)ccc2O1 |
| InChI | InChI=1S/C17H25NO2/c1-16(2)9-13-8-12(4-7-15(13)20-16)10-18-17(3,11-19)14-5-6-14/h4,7-8,14,18-19H,5-6,9-11H2,1-3H3 |
| InChIKey | OEDYHDIEFUHYOY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol?
The IUPAC name of 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol (CID 111977137) is 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol.
What is the SMILES notation for 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol?
The canonical SMILES for 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol is CC1(C)Cc2cc(CNC(C)(CO)C3CC3)ccc2O1.
What is the InChIKey of 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol?
The InChIKey is OEDYHDIEFUHYOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-16(2)9-13-8-12(4-7-15(13)20-16)10-18-17(3,11-19)14-5-6-14/h4,7-8,14,18-19H,5-6,9-11H2,1-3H3.
What are the key properties of 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol?
2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol has a molecular weight of 275.39 g/mol, XLogP of 2.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methylamino]propan-1-ol is sourced from PubChem (CID 111977137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).