C18H36O2Si — CID 11197759
tert-butyl-[(5Z)-8-ethoxydeca-5,9-dienoxy]-dimethylsilane (PubChem CID 11197759) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is tert-butyl-[(5Z)-8-ethoxydeca-5,9-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(5Z)-8-ethoxydeca-5,9-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11197759 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | tert-butyl-[(5Z)-8-ethoxydeca-5,9-dienoxy]-dimethylsilane |
| SMILES | C=CC(C/C=C\CCCCO[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C18H36O2Si/c1-8-17(19-9-2)15-13-11-10-12-14-16-20-21(6,7)18(3,4)5/h8,11,13,17H,1,9-10,12,14-16H2,2-7H3/b13-11- |
| InChIKey | HMWUPPQVEJUDKJ-QBFSEMIESA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|