C21H35IN4 — CID 111978291
1-[(4-tert-butylphenyl)methyl]-2-methyl-3-(1-prop-2-enylpiperidin-4-yl)guanidine;hydroiodide (PubChem CID 111978291) has the molecular formula C21H35IN4 and a molecular weight of 470.44 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-2-methyl-3-(1-prop-2-enylpiperidin-4-yl)guanidine;hydroiodide.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-2-methyl-3-(1-prop-2-enylpiperidin-4-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111978291 |
| Molecular Formula | C21H35IN4 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-2-methyl-3-(1-prop-2-enylpiperidin-4-yl)guanidine;hydroiodide |
| SMILES | C=CCN1CCC(N/C(=N/C)NCc2ccc(C(C)(C)C)cc2)CC1.I |
| InChI | InChI=1S/C21H34N4.HI/c1-6-13-25-14-11-19(12-15-25)24-20(22-5)23-16-17-7-9-18(10-8-17)21(2,3)4;/h6-10,19H,1,11-16H2,2-5H3,(H2,22,23,24);1H |
| InChIKey | PBJCJODNYUMRGG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|