C22H36N4 — CID 111978310
1-[(4-tert-butylphenyl)methyl]-2-methyl-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine (PubChem CID 111978310) has the molecular formula C22H36N4 and a molecular weight of 356.56 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-2-methyl-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-2-methyl-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine |
|---|---|
| PubChem CID | 111978310 |
| Molecular Formula | C22H36N4 |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-2-methyl-3-[1-(2-methylprop-2-enyl)piperidin-4-yl]guanidine |
| SMILES | C=C(C)CN1CCC(N/C(=N/C)NCc2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H36N4/c1-17(2)16-26-13-11-20(12-14-26)25-21(23-6)24-15-18-7-9-19(10-8-18)22(3,4)5/h7-10,20H,1,11-16H2,2-6H3,(H2,23,24,25) |
| InChIKey | CKLBZLBKCLRDJH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|