C20H29IN4O2 — CID 111979558
1-ethyl-3-(4-hydroxycyclohexyl)-2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111979558) has the molecular formula C20H29IN4O2 and a molecular weight of 484.38 g/mol. Its IUPAC name is 1-ethyl-3-(4-hydroxycyclohexyl)-2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979558 |
| Molecular Formula | C20H29IN4O2 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-ethyl-3-(4-hydroxycyclohexyl)-2-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccc(C)cc2)o1)NC1CCC(O)CC1.I |
| InChI | InChI=1S/C20H28N4O2.HI/c1-3-21-20(24-16-8-10-17(25)11-9-16)23-13-19-22-12-18(26-19)15-6-4-14(2)5-7-15;/h4-7,12,16-17,25H,3,8-11,13H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | JUGXIWLIRHHTPT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|