C18H28O3Si — CID 11198011
(2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-(3-trimethylsilylprop-2-ynyl)-3,3a,6,6a-tetrahydro-2H-pentalen-1-one (PubChem CID 11198011) has the molecular formula C18H28O3Si and a molecular weight of 320.51 g/mol. Its IUPAC name is (2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-(3-trimethylsilylprop-2-ynyl)-3,3a,6,6a-tetrahydro-2H-pentalen-1-one.
| Compound Name | (2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-(3-trimethylsilylprop-2-ynyl)-3,3a,6,6a-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11198011 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-(3-trimethylsilylprop-2-ynyl)-3,3a,6,6a-tetrahydro-2H-pentalen-1-one |
| SMILES | COC(OC)[C@@H]1C(=O)[C@H]2[C@H](C=C[C@@H]2C)[C@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C18H28O3Si/c1-12-9-10-14-13(8-7-11-22(4,5)6)16(17(19)15(12)14)18(20-2)21-3/h9-10,12-16,18H,8H2,1-6H3/t12-,13+,14+,15+,16-/m0/s1 |
| InChIKey | PWXMOSVXHIWELT-GCSSGZNBSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|