C15H20O3 — CID 162401574
(2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-prop-2-ynyl-3,3a,6,6a-tetrahydro-2H-pentalen-1-one (PubChem CID 162401574) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-prop-2-ynyl-3,3a,6,6a-tetrahydro-2H-pentalen-1-one.
| Compound Name | (2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-prop-2-ynyl-3,3a,6,6a-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 162401574 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2R,3R,3aR,6S,6aR)-2-(dimethoxymethyl)-6-methyl-3-prop-2-ynyl-3,3a,6,6a-tetrahydro-2H-pentalen-1-one |
| SMILES | C#CC[C@@H]1[C@H]2C=C[C@H](C)[C@H]2C(=O)[C@H]1C(OC)OC |
| InChI | InChI=1S/C15H20O3/c1-5-6-10-11-8-7-9(2)12(11)14(16)13(10)15(17-3)18-4/h1,7-13,15H,6H2,2-4H3/t9-,10+,11+,12+,13-/m0/s1 |
| InChIKey | FVWSVVBLYAJVFQ-CLPYTZEMSA-N |
| XLogP | 1.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|