C22H23F3IN3O — CID 111980740
1-(3,4-dihydro-2H-chromen-4-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide (PubChem CID 111980740) has the molecular formula C22H23F3IN3O and a molecular weight of 529.34 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111980740 |
| Molecular Formula | C22H23F3IN3O |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-ethyl-2-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC#Cc1cccc(C(F)(F)F)c1)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C22H22F3N3O.HI/c1-2-26-21(28-19-12-14-29-20-11-4-3-10-18(19)20)27-13-6-8-16-7-5-9-17(15-16)22(23,24)25;/h3-5,7,9-11,15,19H,2,12-14H2,1H3,(H2,26,27,28);1H |
| InChIKey | DZOZEEDWXFPMIJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|