C22H31IN4O4S — CID 111982680
1-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111982680) has the molecular formula C22H31IN4O4S and a molecular weight of 574.49 g/mol. Its IUPAC name is 1-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111982680 |
| Molecular Formula | C22H31IN4O4S |
| Molecular Weight | 574.49 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 1-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methyl-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)NCc1cccc(S(=O)(=O)NCCOC)c1.I |
| InChI | InChI=1S/C22H30N4O4S.HI/c1-4-13-30-21-11-6-5-9-19(21)17-25-22(23-2)24-16-18-8-7-10-20(15-18)31(27,28)26-12-14-29-3;/h4-11,15,26H,1,12-14,16-17H2,2-3H3,(H2,23,24,25);1H |
| InChIKey | UKRCSLYLVXNGIO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|