C15H25F3N4O2 — CID 111984611
N'-methyl-4-(morpholine-4-carbonyl)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide (PubChem CID 111984611) has the molecular formula C15H25F3N4O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is N'-methyl-4-(morpholine-4-carbonyl)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide.
| Compound Name | N'-methyl-4-(morpholine-4-carbonyl)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111984611 |
| Molecular Formula | C15H25F3N4O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N'-methyl-4-(morpholine-4-carbonyl)-N-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide |
| SMILES | C/N=C(\NCCC(F)(F)F)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C15H25F3N4O2/c1-19-14(20-5-4-15(16,17)18)22-6-2-12(3-7-22)13(23)21-8-10-24-11-9-21/h12H,2-11H2,1H3,(H,19,20) |
| InChIKey | OUDUVQMHJJOOQT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|