C16H27F3N4O2 — CID 111984615
N-ethyl-4-(morpholine-4-carbonyl)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide (PubChem CID 111984615) has the molecular formula C16H27F3N4O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-ethyl-4-(morpholine-4-carbonyl)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-(morpholine-4-carbonyl)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111984615 |
| Molecular Formula | C16H27F3N4O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | N-ethyl-4-(morpholine-4-carbonyl)-N'-(3,3,3-trifluoropropyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C16H27F3N4O2/c1-2-20-15(21-6-5-16(17,18)19)23-7-3-13(4-8-23)14(24)22-9-11-25-12-10-22/h13H,2-12H2,1H3,(H,20,21) |
| InChIKey | YBPPHORQRCJDEC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|