C23H29IN4O3 — CID 111985552
1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111985552) has the molecular formula C23H29IN4O3 and a molecular weight of 536.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111985552 |
| Molecular Formula | C23H29IN4O3 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCC(O)c1cccc(OC)c1.I |
| InChI | InChI=1S/C23H28N4O3.HI/c1-4-24-23(26-14-21(28)18-6-5-7-20(12-18)29-3)25-13-19-15-30-22(27-19)17-10-8-16(2)9-11-17;/h5-12,15,21,28H,4,13-14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | ZQBJKERRTAIHDL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|