C23H27FN4O3 — CID 111986877
1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine (PubChem CID 111986877) has the molecular formula C23H27FN4O3 and a molecular weight of 426.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111986877 |
| Molecular Formula | C23H27FN4O3 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN4O3/c1-3-25-23(27-13-20(29)15-30-21-10-8-18(24)9-11-21)26-12-19-14-31-22(28-19)17-6-4-16(2)5-7-17/h4-11,14,20,29H,3,12-13,15H2,1-2H3,(H2,25,26,27) |
| InChIKey | IWDCSHCSDOOPIX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|