C20H29IN4O3 — CID 111981028
1-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111981028) has the molecular formula C20H29IN4O3 and a molecular weight of 500.38 g/mol. Its IUPAC name is 1-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111981028 |
| Molecular Formula | C20H29IN4O3 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 1-[3-(cyclopropylmethoxy)-2-hydroxypropyl]-3-ethyl-2-[(2-phenyl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccccc2)n1)NCC(O)COCC1CC1.I |
| InChI | InChI=1S/C20H28N4O3.HI/c1-2-21-20(23-11-18(25)14-26-12-15-8-9-15)22-10-17-13-27-19(24-17)16-6-4-3-5-7-16;/h3-7,13,15,18,25H,2,8-12,14H2,1H3,(H2,21,22,23);1H |
| InChIKey | QIQINBIZDFYVNN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|