C16H24FIN6O2 — CID 111990832
1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111990832) has the molecular formula C16H24FIN6O2 and a molecular weight of 478.31 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111990832 |
| Molecular Formula | C16H24FIN6O2 |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenoxy)-2-hydroxypropyl]-2-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncnn1C)NCC(O)COc1ccc(F)cc1.I |
| InChI | InChI=1S/C16H23FN6O2.HI/c1-3-18-16(20-9-15-21-11-22-23(15)2)19-8-13(24)10-25-14-6-4-12(17)5-7-14;/h4-7,11,13,24H,3,8-10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | ISTQPPXNGIBRGQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|