C19H33FIN3O3 — CID 111988988
1-[2-(2-butoxyethoxy)ethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide (PubChem CID 111988988) has the molecular formula C19H33FIN3O3 and a molecular weight of 497.39 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111988988 |
| Molecular Formula | C19H33FIN3O3 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-[2-(4-fluorophenoxy)propyl]-2-methylguanidine;hydroiodide |
| SMILES | CCCCOCCOCCN/C(=N\C)NCC(C)Oc1ccc(F)cc1.I |
| InChI | InChI=1S/C19H32FN3O3.HI/c1-4-5-11-24-13-14-25-12-10-22-19(21-3)23-15-16(2)26-18-8-6-17(20)7-9-18;/h6-9,16H,4-5,10-15H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | IKDHGBLHQKGZCQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|