C21H38N6 — CID 111990509
1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine (PubChem CID 111990509) has the molecular formula C21H38N6 and a molecular weight of 374.58 g/mol. Its IUPAC name is 1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111990509 |
| Molecular Formula | C21H38N6 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-[(1-methylpyrrol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccn(C)c1)NCC1(N2CCCCC2)CCN(C)CC1 |
| InChI | InChI=1S/C21H38N6/c1-4-22-20(23-16-19-8-13-26(3)17-19)24-18-21(9-14-25(2)15-10-21)27-11-6-5-7-12-27/h8,13,17H,4-7,9-12,14-16,18H2,1-3H3,(H2,22,23,24) |
| InChIKey | WRKNQQSOESWUSF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|