C22H36N8 — CID 111497245
1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111497245) has the molecular formula C22H36N8 and a molecular weight of 412.59 g/mol. Its IUPAC name is 1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111497245 |
| Molecular Formula | C22H36N8 |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 1-ethyl-3-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC1(N2CCCCC2)CCN(C)CC1 |
| InChI | InChI=1S/C22H36N8/c1-3-23-21(24-17-20-27-26-19-9-5-8-14-30(19)20)25-18-22(10-15-28(2)16-11-22)29-12-6-4-7-13-29/h5,8-9,14H,3-4,6-7,10-13,15-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | YEFJTOFTNBHJFW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 73.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|