C15H27N5O — CID 111991963
2,2-dimethyl-N-[2-[[N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]carbamimidoyl]amino]ethyl]propanamide (PubChem CID 111991963) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]carbamimidoyl]amino]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]carbamimidoyl]amino]ethyl]propanamide |
|---|---|
| PubChem CID | 111991963 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[(1-methylpyrrol-3-yl)methyl]carbamimidoyl]amino]ethyl]propanamide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NCc1ccn(C)c1 |
| InChI | InChI=1S/C15H27N5O/c1-15(2,3)13(21)17-7-8-18-14(16-4)19-10-12-6-9-20(5)11-12/h6,9,11H,7-8,10H2,1-5H3,(H,17,21)(H2,16,18,19) |
| InChIKey | NTWPEERQSXPIOV-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|