C10H20O6P2S2 — CID 11199253
2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 11199253) has the molecular formula C10H20O6P2S2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 11199253 |
| Molecular Formula | C10H20O6P2S2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)disulfanyl]-5,5-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | CC1(C)COP(=O)(SSP2(=O)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C10H20O6P2S2/c1-9(2)5-13-17(11,14-6-9)19-20-18(12)15-7-10(3,4)8-16-18/h5-8H2,1-4H3 |
| InChIKey | GDXKZFRSJYIGBS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|