C8H8Cl6N2O2 — CID 11199754
[(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 11199754) has the molecular formula C8H8Cl6N2O2 and a molecular weight of 376.88 g/mol. Its IUPAC name is [(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 11199754 |
| Molecular Formula | C8H8Cl6N2O2 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 373.87 |
| IUPAC Name | [(Z)-4-(2,2,2-trichloroethanimidoyl)oxybut-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OC/C=C\CO/C(=N/[H])C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H8Cl6N2O2/c9-7(10,11)5(15)17-3-1-2-4-18-6(16)8(12,13)14/h1-2,15-16H,3-4H2/b2-1-,15-5-,16-6+ |
| InChIKey | MQXBVZLKYNFXEL-TXCQULNFSA-N |
| XLogP | 4.27 |
| TPSA | 66.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|