C17H29BrN4O3S — CID 111997639
1-[2-(2-bromophenoxy)propyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine (PubChem CID 111997639) has the molecular formula C17H29BrN4O3S and a molecular weight of 449.42 g/mol. Its IUPAC name is 1-[2-(2-bromophenoxy)propyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(2-bromophenoxy)propyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111997639 |
| Molecular Formula | C17H29BrN4O3S |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 1-[2-(2-bromophenoxy)propyl]-3-[2-(diethylsulfamoyl)ethyl]-2-methylguanidine |
| SMILES | CCN(CC)S(=O)(=O)CCN/C(=N\C)NCC(C)Oc1ccccc1Br |
| InChI | InChI=1S/C17H29BrN4O3S/c1-5-22(6-2)26(23,24)12-11-20-17(19-4)21-13-14(3)25-16-10-8-7-9-15(16)18/h7-10,14H,5-6,11-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | OCFMAWKJTKHPPE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|