C20H27N3O — CID 111997699
3-(ethoxymethyl)-N'-methyl-N-(naphthalen-2-ylmethyl)pyrrolidine-1-carboximidamide (PubChem CID 111997699) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-(ethoxymethyl)-N'-methyl-N-(naphthalen-2-ylmethyl)pyrrolidine-1-carboximidamide.
| Compound Name | 3-(ethoxymethyl)-N'-methyl-N-(naphthalen-2-ylmethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111997699 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | 3-(ethoxymethyl)-N'-methyl-N-(naphthalen-2-ylmethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCOCC1CCN(/C(=N\C)NCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C20H27N3O/c1-3-24-15-17-10-11-23(14-17)20(21-2)22-13-16-8-9-18-6-4-5-7-19(18)12-16/h4-9,12,17H,3,10-11,13-15H2,1-2H3,(H,21,22) |
| InChIKey | ZIUAKTXGHCCSHP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|