C14H23F3N4 — CID 111997851
3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide (PubChem CID 111997851) has the molecular formula C14H23F3N4 and a molecular weight of 304.36 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111997851 |
| Molecular Formula | C14H23F3N4 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-N-ethyl-N'-(3,3,3-trifluoropropyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC(F)(F)F)N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C14H23F3N4/c1-2-18-13(19-7-6-14(15,16)17)21-10-5-12(11-21)20-8-3-4-9-20/h3-4,12H,2,5-11H2,1H3,(H,18,19) |
| InChIKey | MYLXZFUVMARANF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|