C17H25F3N4 — CID 111998015
2-methyl-1-[1-(4-methylphenyl)piperidin-3-yl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111998015) has the molecular formula C17H25F3N4 and a molecular weight of 342.41 g/mol. Its IUPAC name is 2-methyl-1-[1-(4-methylphenyl)piperidin-3-yl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[1-(4-methylphenyl)piperidin-3-yl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111998015 |
| Molecular Formula | C17H25F3N4 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-methyl-1-[1-(4-methylphenyl)piperidin-3-yl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NC1CCCN(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H25F3N4/c1-13-5-7-15(8-6-13)24-11-3-4-14(12-24)23-16(21-2)22-10-9-17(18,19)20/h5-8,14H,3-4,9-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | XPBRFSPUTRQLLI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|