C20H32F3IN4O — CID 111999112
1-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 111999112) has the molecular formula C20H32F3IN4O and a molecular weight of 528.40 g/mol. Its IUPAC name is 1-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111999112 |
| Molecular Formula | C20H32F3IN4O |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 1-[3-(1-benzylpiperidin-4-yl)oxypropyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOC1CCN(Cc2ccccc2)CC1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C20H31F3N4O.HI/c1-24-19(26-12-10-20(21,22)23)25-11-5-15-28-18-8-13-27(14-9-18)16-17-6-3-2-4-7-17;/h2-4,6-7,18H,5,8-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | RXBYPPHTFDUVJD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|