C21H33F3N4 — CID 109472633
1-[4-(4-benzylpiperidin-1-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109472633) has the molecular formula C21H33F3N4 and a molecular weight of 398.52 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperidin-1-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[4-(4-benzylpiperidin-1-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109472633 |
| Molecular Formula | C21H33F3N4 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-[4-(4-benzylpiperidin-1-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCCCN1CCC(Cc2ccccc2)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C21H33F3N4/c1-25-20(27-13-11-21(22,23)24)26-12-5-6-14-28-15-9-19(10-16-28)17-18-7-3-2-4-8-18/h2-4,7-8,19H,5-6,9-17H2,1H3,(H2,25,26,27) |
| InChIKey | AOGKIRRUBRXZHJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|