C17H21F3N4O2 — CID 109473213
1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473213) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473213 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCCCN1C(=O)c2ccccc2C1=O)NCCC(F)(F)F |
| InChI | InChI=1S/C17H21F3N4O2/c1-21-16(23-10-8-17(18,19)20)22-9-4-5-11-24-14(25)12-6-2-3-7-13(12)15(24)26/h2-3,6-7H,4-5,8-11H2,1H3,(H2,21,22,23) |
| InChIKey | CHWGOJXHHWEJSL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|