C19H29ClN2O4S — CID 11200881
tert-butyl 2-[(2-chloro-5-piperidin-1-ylsulfonylphenyl)methyl-methylamino]acetate (PubChem CID 11200881) has the molecular formula C19H29ClN2O4S and a molecular weight of 416.97 g/mol. Its IUPAC name is tert-butyl 2-[(2-chloro-5-piperidin-1-ylsulfonylphenyl)methyl-methylamino]acetate.
| Compound Name | tert-butyl 2-[(2-chloro-5-piperidin-1-ylsulfonylphenyl)methyl-methylamino]acetate |
|---|---|
| PubChem CID | 11200881 |
| Molecular Formula | C19H29ClN2O4S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | tert-butyl 2-[(2-chloro-5-piperidin-1-ylsulfonylphenyl)methyl-methylamino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)Cc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C19H29ClN2O4S/c1-19(2,3)26-18(23)14-21(4)13-15-12-16(8-9-17(15)20)27(24,25)22-10-6-5-7-11-22/h8-9,12H,5-7,10-11,13-14H2,1-4H3 |
| InChIKey | BMIKNDBBDDNLQX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |