C31H42N4O4S — CID 11203857
N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide (PubChem CID 11203857) has the molecular formula C31H42N4O4S and a molecular weight of 566.77 g/mol. Its IUPAC name is N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 11203857 |
| Molecular Formula | C31H42N4O4S |
| Molecular Weight | 566.77 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | N-[(1R)-6-[3-(2,2-dimethylpropylamino)prop-1-en-2-yl]-1,2,3,4-tetrahydronaphthalen-1-yl]-2-[1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetamide |
| SMILES | C=C(CNCC(C)(C)C)c1ccc2c(c1)CCC[C@H]2NC(=O)CC1C(=O)NCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H42N4O4S/c1-21-9-12-25(13-10-21)40(38,39)35-16-15-33-30(37)28(35)18-29(36)34-27-8-6-7-24-17-23(11-14-26(24)27)22(2)19-32-20-31(3,4)5/h9-14,17,27-28,32H,2,6-8,15-16,18-20H2,1,3-5H3,(H,33,37)(H,34,36)/t27-,28?/m1/s1 |
| InChIKey | QGFMHTRXTADVQA-QXPUDEPPSA-N |
| XLogP | 3.72 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |