C24H26F3N3O7S2 — CID 87680148
[(5S)-5-[[2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 87680148) has the molecular formula C24H26F3N3O7S2 and a molecular weight of 589.61 g/mol. Its IUPAC name is [(5S)-5-[[2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(5S)-5-[[2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87680148 |
| Molecular Formula | C24H26F3N3O7S2 |
| Molecular Weight | 589.61 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | [(5S)-5-[[2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC(=O)[C@H]2CC(=O)N[C@H]2CCCc3cc(OS(=O)(=O)C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C24H26F3N3O7S2/c1-15-5-8-18(9-6-15)38(33,34)30-12-11-28-23(32)21(30)14-22(31)29-20-4-2-3-16-13-17(7-10-19(16)20)37-39(35,36)24(25,26)27/h5-10,13,20-21H,2-4,11-12,14H2,1H3,(H,28,32)(H,29,31)/t20-,21+/m0/s1 |
| InChIKey | UOFIOJCTKYFBTI-LEWJYISDSA-N |
| XLogP | 2.30 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.61 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|