C28H34N4O4S — CID 69080794
2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 69080794) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is 2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 69080794 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2-[(2R)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]-N-[(1R)-6-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC(=O)[C@H]2CC(=O)N[C@@H]2CCCc3cc(C4=CCNCC4)ccc32)cc1 |
| InChI | InChI=1S/C28H34N4O4S/c1-19-5-8-23(9-6-19)37(35,36)32-16-15-30-28(34)26(32)18-27(33)31-25-4-2-3-22-17-21(7-10-24(22)25)20-11-13-29-14-12-20/h5-11,17,25-26,29H,2-4,12-16,18H2,1H3,(H,30,34)(H,31,33)/t25-,26-/m1/s1 |
| InChIKey | CGFGKJJQOQGAQB-CLJLJLNGSA-N |
| XLogP | 2.44 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |