C33H42N4O6S — CID 69257069
tert-butyl 4-[(5R)-5-[[2-[(2S)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 69257069) has the molecular formula C33H42N4O6S and a molecular weight of 622.79 g/mol. Its IUPAC name is tert-butyl 4-[(5R)-5-[[2-[(2S)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5R)-5-[[2-[(2S)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 69257069 |
| Molecular Formula | C33H42N4O6S |
| Molecular Weight | 622.79 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | tert-butyl 4-[(5R)-5-[[2-[(2S)-1-(4-methylphenyl)sulfonyl-3-oxopiperazin-2-yl]acetyl]amino]-5,6,7,8-tetrahydronaphthalen-2-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCNC(=O)[C@@H]2CC(=O)N[C@@H]2CCCc3cc(C4=CCN(C(=O)OC(C)(C)C)CC4)ccc32)cc1 |
| InChI | InChI=1S/C33H42N4O6S/c1-22-8-11-26(12-9-22)44(41,42)37-19-16-34-31(39)29(37)21-30(38)35-28-7-5-6-25-20-24(10-13-27(25)28)23-14-17-36(18-15-23)32(40)43-33(2,3)4/h8-14,20,28-29H,5-7,15-19,21H2,1-4H3,(H,34,39)(H,35,38)/t28-,29+/m1/s1 |
| InChIKey | WLTLOLSKCYVMJI-WDYNHAJCSA-N |
| XLogP | 4.09 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |