C31H48N2O6S3 — CID 11204477
[3-[(E)-1-ethyl-12-pentylsulfanyl-2-(4-sulfamoyloxyphenyl)dodec-1-enyl]phenyl] sulfamate (PubChem CID 11204477) has the molecular formula C31H48N2O6S3 and a molecular weight of 640.93 g/mol. Its IUPAC name is [3-[(E)-1-ethyl-12-pentylsulfanyl-2-(4-sulfamoyloxyphenyl)dodec-1-enyl]phenyl] sulfamate.
| Compound Name | [3-[(E)-1-ethyl-12-pentylsulfanyl-2-(4-sulfamoyloxyphenyl)dodec-1-enyl]phenyl] sulfamate |
|---|---|
| PubChem CID | 11204477 |
| Molecular Formula | C31H48N2O6S3 |
| Molecular Weight | 640.93 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | [3-[(E)-1-ethyl-12-pentylsulfanyl-2-(4-sulfamoyloxyphenyl)dodec-1-enyl]phenyl] sulfamate |
| SMILES | CCCCCSCCCCCCCCCC/C(=C(/CC)c1cccc(OS(N)(=O)=O)c1)c1ccc(OS(N)(=O)=O)cc1 |
| InChI | InChI=1S/C31H48N2O6S3/c1-3-5-13-23-40-24-14-11-9-7-6-8-10-12-18-31(26-19-21-28(22-20-26)38-41(32,34)35)30(4-2)27-16-15-17-29(25-27)39-42(33,36)37/h15-17,19-22,25H,3-14,18,23-24H2,1-2H3,(H2,32,34,35)(H2,33,36,37)/b31-30+ |
| InChIKey | KHFCWKNEGJPBEY-NVQSTNCTSA-N |
| XLogP | 7.61 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.93 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|