C9H16O2 — CID 11205903
(3R,5S,6R)-6-ethyl-3,5-dimethyloxan-2-one (PubChem CID 11205903) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (3R,5S,6R)-6-ethyl-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6R)-6-ethyl-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 11205903 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3R,5S,6R)-6-ethyl-3,5-dimethyloxan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C9H16O2/c1-4-8-6(2)5-7(3)9(10)11-8/h6-8H,4-5H2,1-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | TUTVYKJWIWCAEN-XLPZGREQSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |