C10H20Si — CID 11206005
4,4-dimethylpenta-1,2-dien-3-yl(trimethyl)silane (PubChem CID 11206005) has the molecular formula C10H20Si and a molecular weight of 168.36 g/mol. Its IUPAC name is 4,4-dimethylpenta-1,2-dien-3-yl(trimethyl)silane.
| Compound Name | 4,4-dimethylpenta-1,2-dien-3-yl(trimethyl)silane |
|---|---|
| PubChem CID | 11206005 |
| Molecular Formula | C10H20Si |
| Molecular Weight | 168.36 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 4,4-dimethylpenta-1,2-dien-3-yl(trimethyl)silane |
| SMILES | C=C=C(C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H20Si/c1-8-9(10(2,3)4)11(5,6)7/h1H2,2-7H3 |
| InChIKey | IFBMBQKKTADSQS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|